C11H10BrF2N3OS — CID 114166570
3-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]-4-ethyl-1H-1,2,4-triazol-5-one (PubChem CID 114166570) has the molecular formula C11H10BrF2N3OS and a molecular weight of 350.19 g/mol. Its IUPAC name is 3-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]-4-ethyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]-4-ethyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 114166570 |
| Molecular Formula | C11H10BrF2N3OS |
| Molecular Weight | 350.19 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 3-[(3-bromo-2,6-difluorophenyl)methylsulfanyl]-4-ethyl-1H-1,2,4-triazol-5-one |
| SMILES | CCn1c(SCc2c(F)ccc(Br)c2F)n[nH]c1=O |
| InChI | InChI=1S/C11H10BrF2N3OS/c1-2-17-10(18)15-16-11(17)19-5-6-8(13)4-3-7(12)9(6)14/h3-4H,2,5H2,1H3,(H,15,18) |
| InChIKey | JHFSXKWRTDWPRY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.19 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|