About 5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide
5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide (PubChem CID 114166841) has the molecular formula C8H7N5O2S2
and a molecular weight of 269.31 g/mol. Its IUPAC name is 5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide |
| PubChem CID | 114166841 |
| Molecular Formula | C8H7N5O2S2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | 5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2ccc(C#N)s2)n[nH]1 |
| InChI | InChI=1S/C8H7N5O2S2/c1-5-10-8(12-11-5)13-17(14,15)7-3-2-6(4-9)16-7/h2-3H,1H3,(H2,10,11,12,13) |
| InChIKey | VTXQBKNOFSPGKN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide?
The IUPAC name of 5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide (CID 114166841) is 5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide?
The canonical SMILES for 5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide is Cc1nc(NS(=O)(=O)c2ccc(C#N)s2)n[nH]1.
What is the InChIKey of 5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide?
The InChIKey is VTXQBKNOFSPGKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O2S2/c1-5-10-8(12-11-5)13-17(14,15)7-3-2-6(4-9)16-7/h2-3H,1H3,(H2,10,11,12,13).
What are the key properties of 5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide?
5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide has a molecular weight of 269.31 g/mol, XLogP of 0.85, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-N-(5-methyl-1H-1,2,4-triazol-3-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 114166841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).