C13H16N2O2 — CID 11416698
(11aR)-9-methoxy-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one (PubChem CID 11416698) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is (11aR)-9-methoxy-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one.
| Compound Name | (11aR)-9-methoxy-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one |
|---|---|
| PubChem CID | 11416698 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | (11aR)-9-methoxy-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one |
| SMILES | COc1ccc2c(c1)C[C@@H]1CNCCN1C2=O |
| InChI | InChI=1S/C13H16N2O2/c1-17-11-2-3-12-9(7-11)6-10-8-14-4-5-15(10)13(12)16/h2-3,7,10,14H,4-6,8H2,1H3/t10-/m1/s1 |
| InChIKey | ARGOOWZEEGWQMW-SNVBAGLBSA-N |
| XLogP | 0.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |