C13H25N3O2 — CID 114167213
3-[[2-(azepan-1-yl)-2-oxoethyl]amino]-2,2-dimethylpropanamide (PubChem CID 114167213) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 3-[[2-(azepan-1-yl)-2-oxoethyl]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[2-(azepan-1-yl)-2-oxoethyl]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 114167213 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 3-[[2-(azepan-1-yl)-2-oxoethyl]amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNCC(=O)N1CCCCCC1)C(N)=O |
| InChI | InChI=1S/C13H25N3O2/c1-13(2,12(14)18)10-15-9-11(17)16-7-5-3-4-6-8-16/h15H,3-10H2,1-2H3,(H2,14,18) |
| InChIKey | MJIYZGFQARAANJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |