C11H20N4OS — CID 114167262
N,2,2-trimethyl-3-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)propanamide (PubChem CID 114167262) has the molecular formula C11H20N4OS and a molecular weight of 256.37 g/mol. Its IUPAC name is N,2,2-trimethyl-3-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)propanamide.
| Compound Name | N,2,2-trimethyl-3-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)propanamide |
|---|---|
| PubChem CID | 114167262 |
| Molecular Formula | C11H20N4OS |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N,2,2-trimethyl-3-(3-propan-2-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)propanamide |
| SMILES | CNC(=O)C(C)(C)Cn1c(C(C)C)n[nH]c1=S |
| InChI | InChI=1S/C11H20N4OS/c1-7(2)8-13-14-10(17)15(8)6-11(3,4)9(16)12-5/h7H,6H2,1-5H3,(H,12,16)(H,14,17) |
| InChIKey | JKZPSDSQIGNUKM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|