C12H15N5 — CID 114167883
2-[1-(1H-1,2,4-triazol-5-yl)ethyl]-1,3-dihydroisoindol-4-amine (PubChem CID 114167883) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is 2-[1-(1H-1,2,4-triazol-5-yl)ethyl]-1,3-dihydroisoindol-4-amine.
| Compound Name | 2-[1-(1H-1,2,4-triazol-5-yl)ethyl]-1,3-dihydroisoindol-4-amine |
|---|---|
| PubChem CID | 114167883 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2-[1-(1H-1,2,4-triazol-5-yl)ethyl]-1,3-dihydroisoindol-4-amine |
| SMILES | CC(c1ncn[nH]1)N1Cc2cccc(N)c2C1 |
| InChI | InChI=1S/C12H15N5/c1-8(12-14-7-15-16-12)17-5-9-3-2-4-11(13)10(9)6-17/h2-4,7-8H,5-6,13H2,1H3,(H,14,15,16) |
| InChIKey | PLRPBWDOTZXATA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|