C11H13BrN4O — CID 114167887
4-bromo-2-[[1-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenol (PubChem CID 114167887) has the molecular formula C11H13BrN4O and a molecular weight of 297.16 g/mol. Its IUPAC name is 4-bromo-2-[[1-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenol.
| Compound Name | 4-bromo-2-[[1-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 114167887 |
| Molecular Formula | C11H13BrN4O |
| Molecular Weight | 297.16 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 4-bromo-2-[[1-(1H-1,2,4-triazol-5-yl)ethylamino]methyl]phenol |
| SMILES | CC(NCc1cc(Br)ccc1O)c1ncn[nH]1 |
| InChI | InChI=1S/C11H13BrN4O/c1-7(11-14-6-15-16-11)13-5-8-4-9(12)2-3-10(8)17/h2-4,6-7,13,17H,5H2,1H3,(H,14,15,16) |
| InChIKey | SLNXEUIJZZALCN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.16 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|