C14H12FN5OS2 — CID 11416792
N-[5-[2-[(6-fluoro-3-pyridinyl)amino]-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 11416792) has the molecular formula C14H12FN5OS2 and a molecular weight of 349.42 g/mol. Its IUPAC name is N-[5-[2-[(6-fluoro-3-pyridinyl)amino]-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[2-[(6-fluoro-3-pyridinyl)amino]-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 11416792 |
| Molecular Formula | C14H12FN5OS2 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-[5-[2-[(6-fluoro-3-pyridinyl)amino]-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(-c2csc(Nc3ccc(F)nc3)n2)s1 |
| InChI | InChI=1S/C14H12FN5OS2/c1-7-12(23-14(17-7)18-8(2)21)10-6-22-13(20-10)19-9-3-4-11(15)16-5-9/h3-6H,1-2H3,(H,19,20)(H,17,18,21) |
| InChIKey | FYXGJMSNAUTZID-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|