C10H11ClN6O — CID 114168046
4-chloro-2-methyl-6-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrimidine-5-carbaldehyde (PubChem CID 114168046) has the molecular formula C10H11ClN6O and a molecular weight of 266.69 g/mol. Its IUPAC name is 4-chloro-2-methyl-6-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-2-methyl-6-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 114168046 |
| Molecular Formula | C10H11ClN6O |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 4-chloro-2-methyl-6-[1-(1H-1,2,4-triazol-5-yl)ethylamino]pyrimidine-5-carbaldehyde |
| SMILES | Cc1nc(Cl)c(C=O)c(NC(C)c2ncn[nH]2)n1 |
| InChI | InChI=1S/C10H11ClN6O/c1-5(9-12-4-13-17-9)14-10-7(3-18)8(11)15-6(2)16-10/h3-5H,1-2H3,(H,12,13,17)(H,14,15,16) |
| InChIKey | ADJKNSRHKVHZFR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|