C13H27N3S — CID 114168305
N',N'-dimethyl-N-(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)propane-1,3-diamine (PubChem CID 114168305) has the molecular formula C13H27N3S and a molecular weight of 257.45 g/mol. Its IUPAC name is N',N'-dimethyl-N-(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 114168305 |
| Molecular Formula | C13H27N3S |
| Molecular Weight | 257.45 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | N',N'-dimethyl-N-(5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-yl)propane-1,3-diamine |
| SMILES | CCC(CC)C1CN=C(NCCCN(C)C)S1 |
| InChI | InChI=1S/C13H27N3S/c1-5-11(6-2)12-10-15-13(17-12)14-8-7-9-16(3)4/h11-12H,5-10H2,1-4H3,(H,14,15) |
| InChIKey | IBDLJOUZQKXKTR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.45 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|