C13H20ClNO2S — CID 114168687
N-(2-chloro-3-ethylpentyl)-3-methoxythiophene-2-carboxamide (PubChem CID 114168687) has the molecular formula C13H20ClNO2S and a molecular weight of 289.83 g/mol. Its IUPAC name is N-(2-chloro-3-ethylpentyl)-3-methoxythiophene-2-carboxamide.
| Compound Name | N-(2-chloro-3-ethylpentyl)-3-methoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 114168687 |
| Molecular Formula | C13H20ClNO2S |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(2-chloro-3-ethylpentyl)-3-methoxythiophene-2-carboxamide |
| SMILES | CCC(CC)C(Cl)CNC(=O)c1sccc1OC |
| InChI | InChI=1S/C13H20ClNO2S/c1-4-9(5-2)10(14)8-15-13(16)12-11(17-3)6-7-18-12/h6-7,9-10H,4-5,8H2,1-3H3,(H,15,16) |
| InChIKey | JTDLSDIORXLYOO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|