C20H32O5 — CID 11416874
(1S,2E,5S,6R,10S,14R)-5-hydroxy-10-(hydroxymethyl)-6,14-dimethyl-3-propan-2-yl-15-oxabicyclo[12.1.0]pentadec-2-ene-4,9-dione (PubChem CID 11416874) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (1S,2E,5S,6R,10S,14R)-5-hydroxy-10-(hydroxymethyl)-6,14-dimethyl-3-propan-2-yl-15-oxabicyclo[12.1.0]pentadec-2-ene-4,9-dione.
| Compound Name | (1S,2E,5S,6R,10S,14R)-5-hydroxy-10-(hydroxymethyl)-6,14-dimethyl-3-propan-2-yl-15-oxabicyclo[12.1.0]pentadec-2-ene-4,9-dione |
|---|---|
| PubChem CID | 11416874 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (1S,2E,5S,6R,10S,14R)-5-hydroxy-10-(hydroxymethyl)-6,14-dimethyl-3-propan-2-yl-15-oxabicyclo[12.1.0]pentadec-2-ene-4,9-dione |
| SMILES | CC(C)/C1=C\[C@@H]2O[C@]2(C)CCC[C@@H](CO)C(=O)CC[C@@H](C)[C@H](O)C1=O |
| InChI | InChI=1S/C20H32O5/c1-12(2)15-10-17-20(4,25-17)9-5-6-14(11-21)16(22)8-7-13(3)18(23)19(15)24/h10,12-14,17-18,21,23H,5-9,11H2,1-4H3/b15-10+/t13-,14+,17+,18+,20-/m1/s1 |
| InChIKey | UOCSSAQKXPCRQA-DWGTWPKISA-N |
| XLogP | 2.43 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|