C10H10ClF4NS — CID 114169030
2-chloro-N-(2,2,3,3-tetrafluoropropyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine (PubChem CID 114169030) has the molecular formula C10H10ClF4NS and a molecular weight of 287.71 g/mol. Its IUPAC name is 2-chloro-N-(2,2,3,3-tetrafluoropropyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine.
| Compound Name | 2-chloro-N-(2,2,3,3-tetrafluoropropyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
|---|---|
| PubChem CID | 114169030 |
| Molecular Formula | C10H10ClF4NS |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-chloro-N-(2,2,3,3-tetrafluoropropyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
| SMILES | FC(F)C(F)(F)CNC1CCc2sc(Cl)cc21 |
| InChI | InChI=1S/C10H10ClF4NS/c11-8-3-5-6(1-2-7(5)17-8)16-4-10(14,15)9(12)13/h3,6,9,16H,1-2,4H2 |
| InChIKey | RNJDJADJAGDDKP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|