C11H17F4NO3 — CID 114169131
2-methyl-4-oxo-2-propan-2-yl-4-(2,2,3,3-tetrafluoropropylamino)butanoic acid (PubChem CID 114169131) has the molecular formula C11H17F4NO3 and a molecular weight of 287.25 g/mol. Its IUPAC name is 2-methyl-4-oxo-2-propan-2-yl-4-(2,2,3,3-tetrafluoropropylamino)butanoic acid.
| Compound Name | 2-methyl-4-oxo-2-propan-2-yl-4-(2,2,3,3-tetrafluoropropylamino)butanoic acid |
|---|---|
| PubChem CID | 114169131 |
| Molecular Formula | C11H17F4NO3 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-methyl-4-oxo-2-propan-2-yl-4-(2,2,3,3-tetrafluoropropylamino)butanoic acid |
| SMILES | CC(C)C(C)(CC(=O)NCC(F)(F)C(F)F)C(=O)O |
| InChI | InChI=1S/C11H17F4NO3/c1-6(2)10(3,9(18)19)4-7(17)16-5-11(14,15)8(12)13/h6,8H,4-5H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | AXPOVSIGRRVIBJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|