C12H13F4NO — CID 114169236
2-methyl-1-(2,2,3,3-tetrafluoropropyl)-6,7-dihydro-5H-indol-4-one (PubChem CID 114169236) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 2-methyl-1-(2,2,3,3-tetrafluoropropyl)-6,7-dihydro-5H-indol-4-one.
| Compound Name | 2-methyl-1-(2,2,3,3-tetrafluoropropyl)-6,7-dihydro-5H-indol-4-one |
|---|---|
| PubChem CID | 114169236 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-methyl-1-(2,2,3,3-tetrafluoropropyl)-6,7-dihydro-5H-indol-4-one |
| SMILES | Cc1cc2c(n1CC(F)(F)C(F)F)CCCC2=O |
| InChI | InChI=1S/C12H13F4NO/c1-7-5-8-9(3-2-4-10(8)18)17(7)6-12(15,16)11(13)14/h5,11H,2-4,6H2,1H3 |
| InChIKey | WAOMGVIPWUNQIW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|