C10H11ClF4N2O2 — CID 114169287
6-chloro-5-propan-2-yl-3-(2,2,3,3-tetrafluoropropyl)-1H-pyrimidine-2,4-dione (PubChem CID 114169287) has the molecular formula C10H11ClF4N2O2 and a molecular weight of 302.66 g/mol. Its IUPAC name is 6-chloro-5-propan-2-yl-3-(2,2,3,3-tetrafluoropropyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-chloro-5-propan-2-yl-3-(2,2,3,3-tetrafluoropropyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 114169287 |
| Molecular Formula | C10H11ClF4N2O2 |
| Molecular Weight | 302.66 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 6-chloro-5-propan-2-yl-3-(2,2,3,3-tetrafluoropropyl)-1H-pyrimidine-2,4-dione |
| SMILES | CC(C)c1c(Cl)[nH]c(=O)n(CC(F)(F)C(F)F)c1=O |
| InChI | InChI=1S/C10H11ClF4N2O2/c1-4(2)5-6(11)16-9(19)17(7(5)18)3-10(14,15)8(12)13/h4,8H,3H2,1-2H3,(H,16,19) |
| InChIKey | FWWYIAMBLDNUCY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.66 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|