C10H16F4N2O — CID 114169288
N-cyclopropyl-N-ethyl-2-(2,2,3,3-tetrafluoropropylamino)acetamide (PubChem CID 114169288) has the molecular formula C10H16F4N2O and a molecular weight of 256.24 g/mol. Its IUPAC name is N-cyclopropyl-N-ethyl-2-(2,2,3,3-tetrafluoropropylamino)acetamide.
| Compound Name | N-cyclopropyl-N-ethyl-2-(2,2,3,3-tetrafluoropropylamino)acetamide |
|---|---|
| PubChem CID | 114169288 |
| Molecular Formula | C10H16F4N2O |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-cyclopropyl-N-ethyl-2-(2,2,3,3-tetrafluoropropylamino)acetamide |
| SMILES | CCN(C(=O)CNCC(F)(F)C(F)F)C1CC1 |
| InChI | InChI=1S/C10H16F4N2O/c1-2-16(7-3-4-7)8(17)5-15-6-10(13,14)9(11)12/h7,9,15H,2-6H2,1H3 |
| InChIKey | NZZREMUAFYVKLO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|