C19H34O4Si — CID 11416930
(1R,2R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethoxy-1-prop-2-enyl-2,4,5,6-tetrahydro-1H-pentalen-2-ol (PubChem CID 11416930) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is (1R,2R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethoxy-1-prop-2-enyl-2,4,5,6-tetrahydro-1H-pentalen-2-ol.
| Compound Name | (1R,2R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethoxy-1-prop-2-enyl-2,4,5,6-tetrahydro-1H-pentalen-2-ol |
|---|---|
| PubChem CID | 11416930 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (1R,2R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethoxy-1-prop-2-enyl-2,4,5,6-tetrahydro-1H-pentalen-2-ol |
| SMILES | C=CC[C@@H]1C2=C(CC[C@@H]2O[Si](C)(C)C(C)(C)C)C(OC)(OC)[C@@H]1O |
| InChI | InChI=1S/C19H34O4Si/c1-9-10-13-16-14(19(21-5,22-6)17(13)20)11-12-15(16)23-24(7,8)18(2,3)4/h9,13,15,17,20H,1,10-12H2,2-8H3/t13-,15+,17-/m1/s1 |
| InChIKey | FOSILHHKZMGVKE-UKPHBRMFSA-N |
| XLogP | 4.02 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|