C9H9F4N5 — CID 114169620
3-methyl-N-(2,2,3,3-tetrafluoropropyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 114169620) has the molecular formula C9H9F4N5 and a molecular weight of 263.20 g/mol. Its IUPAC name is 3-methyl-N-(2,2,3,3-tetrafluoropropyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | 3-methyl-N-(2,2,3,3-tetrafluoropropyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 114169620 |
| Molecular Formula | C9H9F4N5 |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-methyl-N-(2,2,3,3-tetrafluoropropyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | Cc1nnc2c(NCC(F)(F)C(F)F)nccn12 |
| InChI | InChI=1S/C9H9F4N5/c1-5-16-17-7-6(14-2-3-18(5)7)15-4-9(12,13)8(10)11/h2-3,8H,4H2,1H3,(H,14,15) |
| InChIKey | QGRIRUQRNRYDSZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|