C10H10F4N4 — CID 114169666
1-methyl-N-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-c]pyridin-4-amine (PubChem CID 114169666) has the molecular formula C10H10F4N4 and a molecular weight of 262.21 g/mol. Its IUPAC name is 1-methyl-N-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-methyl-N-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 114169666 |
| Molecular Formula | C10H10F4N4 |
| Molecular Weight | 262.21 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-methyl-N-(2,2,3,3-tetrafluoropropyl)imidazo[4,5-c]pyridin-4-amine |
| SMILES | Cn1cnc2c(NCC(F)(F)C(F)F)nccc21 |
| InChI | InChI=1S/C10H10F4N4/c1-18-5-17-7-6(18)2-3-15-8(7)16-4-10(13,14)9(11)12/h2-3,5,9H,4H2,1H3,(H,15,16) |
| InChIKey | TWQYKMMDECGDDN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|