C8H8F4N2O4 — CID 114169822
5-(2,2,3,3-tetrafluoropropylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid (PubChem CID 114169822) has the molecular formula C8H8F4N2O4 and a molecular weight of 272.15 g/mol. Its IUPAC name is 5-(2,2,3,3-tetrafluoropropylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(2,2,3,3-tetrafluoropropylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 114169822 |
| Molecular Formula | C8H8F4N2O4 |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 5-(2,2,3,3-tetrafluoropropylcarbamoyl)-4,5-dihydro-1,2-oxazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NOC(C(=O)NCC(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C8H8F4N2O4/c9-7(10)8(11,12)2-13-5(15)4-1-3(6(16)17)14-18-4/h4,7H,1-2H2,(H,13,15)(H,16,17) |
| InChIKey | KPCOCODCZMAYCC-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|