C9H9F4N3O2 — CID 114169910
5-nitro-3-N-(2,2,3,3-tetrafluoropropyl)benzene-1,3-diamine (PubChem CID 114169910) has the molecular formula C9H9F4N3O2 and a molecular weight of 267.18 g/mol. Its IUPAC name is 5-nitro-3-N-(2,2,3,3-tetrafluoropropyl)benzene-1,3-diamine.
| Compound Name | 5-nitro-3-N-(2,2,3,3-tetrafluoropropyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 114169910 |
| Molecular Formula | C9H9F4N3O2 |
| Molecular Weight | 267.18 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 5-nitro-3-N-(2,2,3,3-tetrafluoropropyl)benzene-1,3-diamine |
| SMILES | Nc1cc(NCC(F)(F)C(F)F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H9F4N3O2/c10-8(11)9(12,13)4-15-6-1-5(14)2-7(3-6)16(17)18/h1-3,8,15H,4,14H2 |
| InChIKey | LKVDPHYLOZOTRD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.18 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|