C9H12F5NO3 — CID 114170053
2,2,3,3,3-pentafluoro-N-[4-(hydroxymethyl)oxan-4-yl]propanamide (PubChem CID 114170053) has the molecular formula C9H12F5NO3 and a molecular weight of 277.19 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[4-(hydroxymethyl)oxan-4-yl]propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[4-(hydroxymethyl)oxan-4-yl]propanamide |
|---|---|
| PubChem CID | 114170053 |
| Molecular Formula | C9H12F5NO3 |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[4-(hydroxymethyl)oxan-4-yl]propanamide |
| SMILES | O=C(NC1(CO)CCOCC1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H12F5NO3/c10-8(11,9(12,13)14)6(17)15-7(5-16)1-3-18-4-2-7/h16H,1-5H2,(H,15,17) |
| InChIKey | AATLFLGDCUJROB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|