C8H16F3N3O3S — CID 114170108
4-(aminomethyl)-N-(2,2,2-trifluoroethylsulfamoyl)oxan-4-amine (PubChem CID 114170108) has the molecular formula C8H16F3N3O3S and a molecular weight of 291.30 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2,2,2-trifluoroethylsulfamoyl)oxan-4-amine.
| Compound Name | 4-(aminomethyl)-N-(2,2,2-trifluoroethylsulfamoyl)oxan-4-amine |
|---|---|
| PubChem CID | 114170108 |
| Molecular Formula | C8H16F3N3O3S |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-(aminomethyl)-N-(2,2,2-trifluoroethylsulfamoyl)oxan-4-amine |
| SMILES | NCC1(NS(=O)(=O)NCC(F)(F)F)CCOCC1 |
| InChI | InChI=1S/C8H16F3N3O3S/c9-8(10,11)6-13-18(15,16)14-7(5-12)1-3-17-4-2-7/h13-14H,1-6,12H2 |
| InChIKey | RHIZQLYWFCWTAV-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |