About 4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid
4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid (PubChem CID 114170919) has the molecular formula C12H14N4O3
and a molecular weight of 262.27 g/mol. Its IUPAC name is 4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid |
| PubChem CID | 114170919 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid |
| SMILES | CCn1cnnc1Cn1cc(C(C)=O)cc1C(=O)O |
| InChI | InChI=1S/C12H14N4O3/c1-3-15-7-13-14-11(15)6-16-5-9(8(2)17)4-10(16)12(18)19/h4-5,7H,3,6H2,1-2H3,(H,18,19) |
| InChIKey | OFMOFAZAKNVGAJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid?
The IUPAC name of 4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid (CID 114170919) is 4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid.
What is the SMILES notation for 4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid?
The canonical SMILES for 4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid is CCn1cnnc1Cn1cc(C(C)=O)cc1C(=O)O.
What is the InChIKey of 4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid?
The InChIKey is OFMOFAZAKNVGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O3/c1-3-15-7-13-14-11(15)6-16-5-9(8(2)17)4-10(16)12(18)19/h4-5,7H,3,6H2,1-2H3,(H,18,19).
What are the key properties of 4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid?
4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid has a molecular weight of 262.27 g/mol, XLogP of 1.05, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-acetyl-1-[(4-ethyl-1,2,4-triazol-3-yl)methyl]pyrrole-2-carboxylic acid is sourced from PubChem (CID 114170919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).