C22H32O4 — CID 11417093
(2S,3R,3aR,6aR)-3-[1-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-2-acetyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one (PubChem CID 11417093) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is (2S,3R,3aR,6aR)-3-[1-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-2-acetyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one.
| Compound Name | (2S,3R,3aR,6aR)-3-[1-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-2-acetyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one |
|---|---|
| PubChem CID | 11417093 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (2S,3R,3aR,6aR)-3-[1-[(1R,3aS,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-2-acetyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-one |
| SMILES | C=C([C@H]1[C@H]2CC(=O)O[C@H]2O[C@@H]1C(C)=O)[C@H]1CC[C@H]2C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C22H32O4/c1-12(15-7-8-16-21(3,4)9-6-10-22(15,16)5)18-14-11-17(24)25-20(14)26-19(18)13(2)23/h14-16,18-20H,1,6-11H2,2-5H3/t14-,15-,16+,18+,19-,20+,22-/m1/s1 |
| InChIKey | ICKXGTZEFSFJCW-LGZGXYNGSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|