C21H32O3Si — CID 11417101
methyl (2E,4R,5S,6Z)-7-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-phenylhepta-2,6-dienoate (PubChem CID 11417101) has the molecular formula C21H32O3Si and a molecular weight of 360.57 g/mol. Its IUPAC name is methyl (2E,4R,5S,6Z)-7-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-phenylhepta-2,6-dienoate.
| Compound Name | methyl (2E,4R,5S,6Z)-7-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-phenylhepta-2,6-dienoate |
|---|---|
| PubChem CID | 11417101 |
| Molecular Formula | C21H32O3Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | methyl (2E,4R,5S,6Z)-7-[tert-butyl(dimethyl)silyl]oxy-5-methyl-4-phenylhepta-2,6-dienoate |
| SMILES | COC(=O)/C=C/[C@@H](c1ccccc1)[C@H](C)/C=C\O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32O3Si/c1-17(15-16-24-25(6,7)21(2,3)4)19(13-14-20(22)23-5)18-11-9-8-10-12-18/h8-17,19H,1-7H3/b14-13+,16-15-/t17-,19-/m1/s1 |
| InChIKey | GUQTUWGRGGZHOT-MKYGHCBJSA-N |
| XLogP | 5.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|