About 2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one
2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one (PubChem CID 114172279) has the molecular formula C11H20N2O3S
and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one.
Molecular Properties
| Compound Name | 2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one |
| PubChem CID | 114172279 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one |
| SMILES | CC1=CCCN(C(=O)C(N)CCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H20N2O3S/c1-9-4-3-6-13(8-9)11(14)10(12)5-7-17(2,15)16/h4,10H,3,5-8,12H2,1-2H3 |
| InChIKey | NZGZQIITFUOSSU-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one?
The IUPAC name of 2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one (CID 114172279) is 2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one.
What is the SMILES notation for 2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one?
The canonical SMILES for 2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one is CC1=CCCN(C(=O)C(N)CCS(C)(=O)=O)C1.
What is the InChIKey of 2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one?
The InChIKey is NZGZQIITFUOSSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3S/c1-9-4-3-6-13(8-9)11(14)10(12)5-7-17(2,15)16/h4,10H,3,5-8,12H2,1-2H3.
What are the key properties of 2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one?
2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one has a molecular weight of 260.36 g/mol, XLogP of -0.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-4-methylsulfonylbutan-1-one is sourced from PubChem (CID 114172279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).