About methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate
methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate (PubChem CID 11417299) has the molecular formula C18H19Cl2NO3
and a molecular weight of 368.26 g/mol. Its IUPAC name is methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate |
| PubChem CID | 11417299 |
| Molecular Formula | C18H19Cl2NO3 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate |
| SMILES | COC(=O)NC(O)CCC(c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H19Cl2NO3/c1-24-18(23)21-17(22)10-8-14(12-5-3-2-4-6-12)13-7-9-15(19)16(20)11-13/h2-7,9,11,14,17,22H,8,10H2,1H3,(H,21,23) |
| InChIKey | KDDICPFHVPJQCZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate?
The IUPAC name of methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate (CID 11417299) is methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate.
What is the SMILES notation for methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate?
The canonical SMILES for methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate is COC(=O)NC(O)CCC(c1ccccc1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate?
The InChIKey is KDDICPFHVPJQCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19Cl2NO3/c1-24-18(23)21-17(22)10-8-14(12-5-3-2-4-6-12)13-7-9-15(19)16(20)11-13/h2-7,9,11,14,17,22H,8,10H2,1H3,(H,21,23).
What are the key properties of methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate?
methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate has a molecular weight of 368.26 g/mol, XLogP of 4.58, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[4-(3,4-dichlorophenyl)-1-hydroxy-4-phenylbutyl]carbamate is sourced from PubChem (CID 11417299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).