C9H13ClN4O3S — CID 114175883
2-[(6-chloro-5-formylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide (PubChem CID 114175883) has the molecular formula C9H13ClN4O3S and a molecular weight of 292.75 g/mol. Its IUPAC name is 2-[(6-chloro-5-formylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide.
| Compound Name | 2-[(6-chloro-5-formylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide |
|---|---|
| PubChem CID | 114175883 |
| Molecular Formula | C9H13ClN4O3S |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-[(6-chloro-5-formylpyrimidin-4-yl)amino]-N-ethylethanesulfonamide |
| SMILES | CCNS(=O)(=O)CCNc1ncnc(Cl)c1C=O |
| InChI | InChI=1S/C9H13ClN4O3S/c1-2-14-18(16,17)4-3-11-9-7(5-15)8(10)12-6-13-9/h5-6,14H,2-4H2,1H3,(H,11,12,13) |
| InChIKey | TYCRRPUIHQCXEU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|