C22H23NO3S — CID 11417666
2-(benzenesulfonyl)-8a-benzyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-one (PubChem CID 11417666) has the molecular formula C22H23NO3S and a molecular weight of 381.50 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-8a-benzyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-one.
| Compound Name | 2-(benzenesulfonyl)-8a-benzyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-one |
|---|---|
| PubChem CID | 11417666 |
| Molecular Formula | C22H23NO3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-(benzenesulfonyl)-8a-benzyl-3,4,7,8-tetrahydro-1H-isoquinolin-6-one |
| SMILES | O=C1C=C2CCN(S(=O)(=O)c3ccccc3)CC2(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H23NO3S/c24-20-11-13-22(16-18-7-3-1-4-8-18)17-23(14-12-19(22)15-20)27(25,26)21-9-5-2-6-10-21/h1-10,15H,11-14,16-17H2 |
| InChIKey | MLKHMNLURPWDME-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |