About (2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide
(2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide (PubChem CID 11417726) has the molecular formula C21H41N3O3
and a molecular weight of 383.58 g/mol. Its IUPAC name is (2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide.
Molecular Properties
| Compound Name | (2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide |
| PubChem CID | 11417726 |
| Molecular Formula | C21H41N3O3 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.31 |
| IUPAC Name | (2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide |
| SMILES | CCCCNC(=O)CC[C@H](NC(=O)C(CC)CCCC)C(=O)NCCCC |
| InChI | InChI=1S/C21H41N3O3/c1-5-9-12-17(8-4)20(26)24-18(21(27)23-16-11-7-3)13-14-19(25)22-15-10-6-2/h17-18H,5-16H2,1-4H3,(H,22,25)(H,23,27)(H,24,26)/t17?,18-/m0/s1 |
| InChIKey | OVUBDKNXJHOLMI-ZVAWYAOSSA-N |
| XLogP | 3.30 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide?
The IUPAC name of (2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide (CID 11417726) is (2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide.
What is the SMILES notation for (2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide?
The canonical SMILES for (2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide is CCCCNC(=O)CC[C@H](NC(=O)C(CC)CCCC)C(=O)NCCCC.
What is the InChIKey of (2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide?
The InChIKey is OVUBDKNXJHOLMI-ZVAWYAOSSA-N. The full InChI is InChI=1S/C21H41N3O3/c1-5-9-12-17(8-4)20(26)24-18(21(27)23-16-11-7-3)13-14-19(25)22-15-10-6-2/h17-18H,5-16H2,1-4H3,(H,22,25)(H,23,27)(H,24,26)/t17?,18-/m0/s1.
What are the key properties of (2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide?
(2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide has a molecular weight of 383.58 g/mol, XLogP of 3.30, 16 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N'-dibutyl-2-(2-ethylhexanoylamino)pentanediamide is sourced from PubChem (CID 11417726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).