About N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine
N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine (PubChem CID 114177287) has the molecular formula C12H23N3OS
and a molecular weight of 257.40 g/mol. Its IUPAC name is N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine.
Molecular Properties
| Compound Name | N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine |
| PubChem CID | 114177287 |
| Molecular Formula | C12H23N3OS |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine |
| SMILES | CC(C)(C)C1CCSC(NN2CCOCC2)=N1 |
| InChI | InChI=1S/C12H23N3OS/c1-12(2,3)10-4-9-17-11(13-10)14-15-5-7-16-8-6-15/h10H,4-9H2,1-3H3,(H,13,14) |
| InChIKey | TWGFNEVDSDFULW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine?
The IUPAC name of N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine (CID 114177287) is N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine.
What is the SMILES notation for N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine?
The canonical SMILES for N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine is CC(C)(C)C1CCSC(NN2CCOCC2)=N1.
What is the InChIKey of N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine?
The InChIKey is TWGFNEVDSDFULW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3OS/c1-12(2,3)10-4-9-17-11(13-10)14-15-5-7-16-8-6-15/h10H,4-9H2,1-3H3,(H,13,14).
What are the key properties of N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine?
N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine has a molecular weight of 257.40 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-tert-butyl-5,6-dihydro-4H-1,3-thiazin-2-yl)morpholin-4-amine is sourced from PubChem (CID 114177287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).