C26H42O2 — CID 11417800
(6R)-24-methylpentacosa-2,4,16-triyne-1,6-diol (PubChem CID 11417800) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is (6R)-24-methylpentacosa-2,4,16-triyne-1,6-diol.
| Compound Name | (6R)-24-methylpentacosa-2,4,16-triyne-1,6-diol |
|---|---|
| PubChem CID | 11417800 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | (6R)-24-methylpentacosa-2,4,16-triyne-1,6-diol |
| SMILES | CC(C)CCCCCCC#CCCCCCCCCC[C@@H](O)C#CC#CCO |
| InChI | InChI=1S/C26H42O2/c1-25(2)21-17-14-12-10-8-6-4-3-5-7-9-11-13-15-18-22-26(28)23-19-16-20-24-27/h25-28H,3,5,7-15,17-18,21-22,24H2,1-2H3/t26-/m1/s1 |
| InChIKey | RAXHFMNIGMNARH-AREMUKBSSA-N |
| XLogP | 5.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|