C11H20N2O2S2 — CID 114178991
N-(1-methylsulfonylpropan-2-yl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine (PubChem CID 114178991) has the molecular formula C11H20N2O2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is N-(1-methylsulfonylpropan-2-yl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine.
| Compound Name | N-(1-methylsulfonylpropan-2-yl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 114178991 |
| Molecular Formula | C11H20N2O2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N-(1-methylsulfonylpropan-2-yl)-4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-amine |
| SMILES | CC(CS(C)(=O)=O)NC1=NC2CCCC2CS1 |
| InChI | InChI=1S/C11H20N2O2S2/c1-8(7-17(2,14)15)12-11-13-10-5-3-4-9(10)6-16-11/h8-10H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | TULGVSXSZUTVMC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |