C14H18ClN3S — CID 114179340
N-[2-(chloromethyl)cyclohexyl]-6-methylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 114179340) has the molecular formula C14H18ClN3S and a molecular weight of 295.84 g/mol. Its IUPAC name is N-[2-(chloromethyl)cyclohexyl]-6-methylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-[2-(chloromethyl)cyclohexyl]-6-methylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114179340 |
| Molecular Formula | C14H18ClN3S |
| Molecular Weight | 295.84 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-[2-(chloromethyl)cyclohexyl]-6-methylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(NC3CCCCC3CCl)ncnc2s1 |
| InChI | InChI=1S/C14H18ClN3S/c1-9-6-11-13(16-8-17-14(11)19-9)18-12-5-3-2-4-10(12)7-15/h6,8,10,12H,2-5,7H2,1H3,(H,16,17,18) |
| InChIKey | RXBVZHIZUIBWLS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.84 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|