About 2-methylcyclohexan-1-ol
2-methylcyclohexan-1-ol (PubChem CID 11418) has the molecular formula C7H14O
and a molecular weight of 114.19 g/mol. Its IUPAC name is 2-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-methylcyclohexan-1-ol |
| PubChem CID | 11418 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | 2-methylcyclohexan-1-ol |
| SMILES | CC1CCCCC1O |
| InChI | InChI=1S/C7H14O/c1-6-4-2-3-5-7(6)8/h6-8H,2-5H2,1H3 |
| InChIKey | NDVWOBYBJYUSMF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylcyclohexan-1-ol?
The IUPAC name of 2-methylcyclohexan-1-ol (CID 11418) is 2-methylcyclohexan-1-ol.
What is the SMILES notation for 2-methylcyclohexan-1-ol?
The canonical SMILES for 2-methylcyclohexan-1-ol is CC1CCCCC1O.
What is the InChIKey of 2-methylcyclohexan-1-ol?
The InChIKey is NDVWOBYBJYUSMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O/c1-6-4-2-3-5-7(6)8/h6-8H,2-5H2,1H3.
What are the key properties of 2-methylcyclohexan-1-ol?
2-methylcyclohexan-1-ol has a molecular weight of 114.19 g/mol, XLogP of 1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylcyclohexan-1-ol is sourced from PubChem (CID 11418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).