C12H13ClFN3O — CID 114180072
4-chloro-1-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-fluorobenzene-1,2-diamine (PubChem CID 114180072) has the molecular formula C12H13ClFN3O and a molecular weight of 269.71 g/mol. Its IUPAC name is 4-chloro-1-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-fluorobenzene-1,2-diamine.
| Compound Name | 4-chloro-1-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 114180072 |
| Molecular Formula | C12H13ClFN3O |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 4-chloro-1-N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-fluorobenzene-1,2-diamine |
| SMILES | Cc1nc(CNc2cc(F)c(Cl)cc2N)oc1C |
| InChI | InChI=1S/C12H13ClFN3O/c1-6-7(2)18-12(17-6)5-16-11-4-9(14)8(13)3-10(11)15/h3-4,16H,5,15H2,1-2H3 |
| InChIKey | CNCGHRQHQLEPQH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|