C11H14N4OS — CID 114180668
3-cyclopropyl-4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 114180668) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is 3-cyclopropyl-4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-cyclopropyl-4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 114180668 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-cyclopropyl-4-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nc(Cn2c(C3CC3)n[nH]c2=S)oc1C |
| InChI | InChI=1S/C11H14N4OS/c1-6-7(2)16-9(12-6)5-15-10(8-3-4-8)13-14-11(15)17/h8H,3-5H2,1-2H3,(H,14,17) |
| InChIKey | SHUSTXLPPUAXMW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|