C10H10FN3O4 — CID 114180984
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-fluoro-1,3-diazinane-2,4,6-trione (PubChem CID 114180984) has the molecular formula C10H10FN3O4 and a molecular weight of 255.20 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-fluoro-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-fluoro-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 114180984 |
| Molecular Formula | C10H10FN3O4 |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-fluoro-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1nc(CN2C(=O)NC(=O)C(F)C2=O)oc1C |
| InChI | InChI=1S/C10H10FN3O4/c1-4-5(2)18-6(12-4)3-14-9(16)7(11)8(15)13-10(14)17/h7H,3H2,1-2H3,(H,13,15,17) |
| InChIKey | LZMVXEZHNPWTFS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|