About [(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate
[(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate (PubChem CID 11418112) has the molecular formula C22H22O5S
and a molecular weight of 398.48 g/mol. Its IUPAC name is [(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate |
| PubChem CID | 11418112 |
| Molecular Formula | C22H22O5S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | [(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](O)c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H22O5S/c1-17-7-13-21(14-8-17)28(24,25)27-16-22(23)19-9-11-20(12-10-19)26-15-18-5-3-2-4-6-18/h2-14,22-23H,15-16H2,1H3/t22-/m0/s1 |
| InChIKey | JMKSBBHKJXTZGR-QFIPXVFZSA-N |
| XLogP | 4.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate?
The IUPAC name of [(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate (CID 11418112) is [(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate?
The canonical SMILES for [(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OC[C@H](O)c2ccc(OCc3ccccc3)cc2)cc1.
What is the InChIKey of [(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate?
The InChIKey is JMKSBBHKJXTZGR-QFIPXVFZSA-N. The full InChI is InChI=1S/C22H22O5S/c1-17-7-13-21(14-8-17)28(24,25)27-16-22(23)19-9-11-20(12-10-19)26-15-18-5-3-2-4-6-18/h2-14,22-23H,15-16H2,1H3/t22-/m0/s1.
What are the key properties of [(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate?
[(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate has a molecular weight of 398.48 g/mol, XLogP of 4.01, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-hydroxy-2-(4-phenylmethoxyphenyl)ethyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 11418112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).