C11H21N5O2 — CID 114181155
1-amino-2-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3-(3-methoxypropyl)guanidine (PubChem CID 114181155) has the molecular formula C11H21N5O2 and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-amino-2-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3-(3-methoxypropyl)guanidine.
| Compound Name | 1-amino-2-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3-(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 114181155 |
| Molecular Formula | C11H21N5O2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 1-amino-2-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3-(3-methoxypropyl)guanidine |
| SMILES | CCc1cnc(C/N=C(/NN)NCCCOC)o1 |
| InChI | InChI=1S/C11H21N5O2/c1-3-9-7-14-10(18-9)8-15-11(16-12)13-5-4-6-17-2/h7H,3-6,8,12H2,1-2H3,(H2,13,15,16) |
| InChIKey | VRNVYQQKYILDAI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|