About 4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one
4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one (PubChem CID 114181398) has the molecular formula C12H18N2O3S
and a molecular weight of 270.35 g/mol. Its IUPAC name is 4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one |
| PubChem CID | 114181398 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(CNC2CCOC3(CCOC3)C2)cs1 |
| InChI | InChI=1S/C12H18N2O3S/c15-11-14-10(7-18-11)6-13-9-1-3-17-12(5-9)2-4-16-8-12/h7,9,13H,1-6,8H2,(H,14,15) |
| InChIKey | UFTCIBNTZHBEPE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one?
The IUPAC name of 4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one (CID 114181398) is 4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one is O=c1[nH]c(CNC2CCOC3(CCOC3)C2)cs1.
What is the InChIKey of 4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one?
The InChIKey is UFTCIBNTZHBEPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3S/c15-11-14-10(7-18-11)6-13-9-1-3-17-12(5-9)2-4-16-8-12/h7,9,13H,1-6,8H2,(H,14,15).
What are the key properties of 4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one?
4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one has a molecular weight of 270.35 g/mol, XLogP of 0.86, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dioxaspiro[4.5]decan-9-ylamino)methyl]-3H-1,3-thiazol-2-one is sourced from PubChem (CID 114181398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).