About 6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile
6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile (PubChem CID 114181486) has the molecular formula C11H10N4OS
and a molecular weight of 246.30 g/mol. Its IUPAC name is 6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile |
| PubChem CID | 114181486 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile |
| SMILES | Cc1ccc(C#N)c(NCc2csc(=O)[nH]2)n1 |
| InChI | InChI=1S/C11H10N4OS/c1-7-2-3-8(4-12)10(14-7)13-5-9-6-17-11(16)15-9/h2-3,6H,5H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | PHGNRPJKPAHMEM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile?
The IUPAC name of 6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile (CID 114181486) is 6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile.
What is the SMILES notation for 6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile?
The canonical SMILES for 6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile is Cc1ccc(C#N)c(NCc2csc(=O)[nH]2)n1.
What is the InChIKey of 6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile?
The InChIKey is PHGNRPJKPAHMEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4OS/c1-7-2-3-8(4-12)10(14-7)13-5-9-6-17-11(16)15-9/h2-3,6H,5H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile?
6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile has a molecular weight of 246.30 g/mol, XLogP of 1.62, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-[(2-oxo-3H-1,3-thiazol-4-yl)methylamino]pyridine-3-carbonitrile is sourced from PubChem (CID 114181486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).