C10H12Br2N6 — CID 114182243
4-[5-(3,5-dibromo-2-pyridinyl)tetrazol-1-yl]butan-1-amine (PubChem CID 114182243) has the molecular formula C10H12Br2N6 and a molecular weight of 376.06 g/mol. Its IUPAC name is 4-[5-(3,5-dibromo-2-pyridinyl)tetrazol-1-yl]butan-1-amine.
| Compound Name | 4-[5-(3,5-dibromo-2-pyridinyl)tetrazol-1-yl]butan-1-amine |
|---|---|
| PubChem CID | 114182243 |
| Molecular Formula | C10H12Br2N6 |
| Molecular Weight | 376.06 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 4-[5-(3,5-dibromo-2-pyridinyl)tetrazol-1-yl]butan-1-amine |
| SMILES | NCCCCn1nnnc1-c1ncc(Br)cc1Br |
| InChI | InChI=1S/C10H12Br2N6/c11-7-5-8(12)9(14-6-7)10-15-16-17-18(10)4-2-1-3-13/h5-6H,1-4,13H2 |
| InChIKey | MNDDMWMPHITCSL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.06 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|