About 7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide
7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide (PubChem CID 114182386) has the molecular formula C13H23N3O2
and a molecular weight of 253.35 g/mol. Its IUPAC name is 7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide.
Molecular Properties
| Compound Name | 7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide |
| PubChem CID | 114182386 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide |
| SMILES | Cc1cnc(C(C)NC(=O)CCCCCCN)o1 |
| InChI | InChI=1S/C13H23N3O2/c1-10-9-15-13(18-10)11(2)16-12(17)7-5-3-4-6-8-14/h9,11H,3-8,14H2,1-2H3,(H,16,17) |
| InChIKey | WIBNKZXRZOAOPV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide?
The IUPAC name of 7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide (CID 114182386) is 7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide.
What is the SMILES notation for 7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide?
The canonical SMILES for 7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide is Cc1cnc(C(C)NC(=O)CCCCCCN)o1.
What is the InChIKey of 7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide?
The InChIKey is WIBNKZXRZOAOPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O2/c1-10-9-15-13(18-10)11(2)16-12(17)7-5-3-4-6-8-14/h9,11H,3-8,14H2,1-2H3,(H,16,17).
What are the key properties of 7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide?
7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide has a molecular weight of 253.35 g/mol, XLogP of 2.07, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]heptanamide is sourced from PubChem (CID 114182386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).