C11H15N5O — CID 114183327
N-[(3-cyclopropylimidazol-4-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine (PubChem CID 114183327) has the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. Its IUPAC name is N-[(3-cyclopropylimidazol-4-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine.
| Compound Name | N-[(3-cyclopropylimidazol-4-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 114183327 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | N-[(3-cyclopropylimidazol-4-yl)methyl]-2-(1,2,4-oxadiazol-5-yl)ethanamine |
| SMILES | c1noc(CCNCc2cncn2C2CC2)n1 |
| InChI | InChI=1S/C11H15N5O/c1-2-9(1)16-8-13-6-10(16)5-12-4-3-11-14-7-15-17-11/h6-9,12H,1-5H2 |
| InChIKey | NIEPWMCRZBOKDF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|