C7H10F3N5O2 — CID 114183947
3,3,3-trifluoro-N'-hydroxy-2-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]propanimidamide (PubChem CID 114183947) has the molecular formula C7H10F3N5O2 and a molecular weight of 253.18 g/mol. Its IUPAC name is 3,3,3-trifluoro-N'-hydroxy-2-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]propanimidamide.
| Compound Name | 3,3,3-trifluoro-N'-hydroxy-2-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]propanimidamide |
|---|---|
| PubChem CID | 114183947 |
| Molecular Formula | C7H10F3N5O2 |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 3,3,3-trifluoro-N'-hydroxy-2-[(1,2,4-oxadiazol-3-ylmethylamino)methyl]propanimidamide |
| SMILES | NC(=NO)C(CNCc1ncon1)C(F)(F)F |
| InChI | InChI=1S/C7H10F3N5O2/c8-7(9,10)4(6(11)14-16)1-12-2-5-13-3-17-15-5/h3-4,12,16H,1-2H2,(H2,11,14) |
| InChIKey | BSHUTBBCTJMGLP-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|