About N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine
N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine (PubChem CID 11418482) has the molecular formula C19H25Cl2N3
and a molecular weight of 366.34 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine.
Molecular Properties
| Compound Name | N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine |
| PubChem CID | 11418482 |
| Molecular Formula | C19H25Cl2N3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine |
| SMILES | CC(C)CNCc1cnc(Nc2ccc(Cl)c(Cl)c2)cc1C(C)C |
| InChI | InChI=1S/C19H25Cl2N3/c1-12(2)9-22-10-14-11-23-19(8-16(14)13(3)4)24-15-5-6-17(20)18(21)7-15/h5-8,11-13,22H,9-10H2,1-4H3,(H,23,24) |
| InChIKey | WRLIFYDQDAJTJH-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine?
The IUPAC name of N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine (CID 11418482) is N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine.
What is the SMILES notation for N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine?
The canonical SMILES for N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine is CC(C)CNCc1cnc(Nc2ccc(Cl)c(Cl)c2)cc1C(C)C.
What is the InChIKey of N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine?
The InChIKey is WRLIFYDQDAJTJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25Cl2N3/c1-12(2)9-22-10-14-11-23-19(8-16(14)13(3)4)24-15-5-6-17(20)18(21)7-15/h5-8,11-13,22H,9-10H2,1-4H3,(H,23,24).
What are the key properties of N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine?
N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine has a molecular weight of 366.34 g/mol, XLogP of 6.00, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dichlorophenyl)-5-[(2-methylpropylamino)methyl]-4-propan-2-ylpyridin-2-amine is sourced from PubChem (CID 11418482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).