C9H10N4O4 — CID 114185364
5,5-dimethyl-1-(1,2,4-oxadiazol-3-ylmethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 114185364) has the molecular formula C9H10N4O4 and a molecular weight of 238.20 g/mol. Its IUPAC name is 5,5-dimethyl-1-(1,2,4-oxadiazol-3-ylmethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-dimethyl-1-(1,2,4-oxadiazol-3-ylmethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 114185364 |
| Molecular Formula | C9H10N4O4 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 5,5-dimethyl-1-(1,2,4-oxadiazol-3-ylmethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CC1(C)C(=O)NC(=O)N(Cc2ncon2)C1=O |
| InChI | InChI=1S/C9H10N4O4/c1-9(2)6(14)11-8(16)13(7(9)15)3-5-10-4-17-12-5/h4H,3H2,1-2H3,(H,11,14,16) |
| InChIKey | RAAKDATXRNGPDA-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|